Difference between revisions of "CPD-9866"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15582 RXN-15582] == * direction: ** left-to-right == Reaction formula == * 1 S-Substituted-L-...")
 
(Created page with "Category:metabolite == Metabolite CPD-9866 == * common-name: ** 2-methoxy-6-(all-trans-nonaprenyl)phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15582 RXN-15582] ==
+
== Metabolite CPD-9866 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 2-methoxy-6-(all-trans-nonaprenyl)phenol
−
== Reaction formula ==
+
* smiles:
−
* 1 [[S-Substituted-L-Cysteines]][c] '''=>''' 1 [[2-AMINOACRYLATE]][c] '''+''' 1 [[Thiols]][c]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ03867]]
+
** xryxraoxvpwhhk-ssrazkmssa-n
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 737.203
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-9240]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
* RHEA:
+
{{#set: common-name=2-methoxy-6-(all-trans-nonaprenyl)phenol}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=43025 43025]
+
{{#set: inchi-key=inchikey=xryxraoxvpwhhk-ssrazkmssa-n}}
−
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=737.203}}
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9866

  • common-name:
    • 2-methoxy-6-(all-trans-nonaprenyl)phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
  • inchi-key:
    • xryxraoxvpwhhk-ssrazkmssa-n
  • molecular-weight:
    • 737.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9866&oldid=139706"