Difference between revisions of "CPD-9866"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14803 RXN-14803] == * direction: ** left-to-right * common-name: ** 3-ketoacyl-coa thiolase **...")
(Created page with "Category:metabolite == Metabolite CPD-9866 == * common-name: ** 2-methoxy-6-(all-trans-nonaprenyl)phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14803 RXN-14803] ==
+
== Metabolite CPD-9866 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-ketoacyl-coa thiolase
+
** 2-methoxy-6-(all-trans-nonaprenyl)phenol
−
** acetyl-coa c-acyltransferase
+
* smiles:
−
* ec-number:
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
−
** [http://enzyme.expasy.org/EC/2.3.1.16 ec-2.3.1.16]
+
* inchi-key:
−
== Reaction formula ==
+
** xryxraoxvpwhhk-ssrazkmssa-n
−
* 1 [[CO-A]][c] '''+''' 1 [[CPD-15691]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[CPD-15692]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 737.203
−
* Gene: [[SJ16470]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-9240]]
−
* Gene: [[SJ21818]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=2-methoxy-6-(all-trans-nonaprenyl)phenol}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=xryxraoxvpwhhk-ssrazkmssa-n}}
−
* Gene: [[SJ21817]]
+
{{#set: molecular-weight=737.203}}
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ09371]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ14898]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-7340]], 9-cis, 11-trans-octadecadienoyl-CoA degradation (isomerase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7340 PWY-7340]
 
−
** '''5''' reactions found over '''10''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=acetyl-coa c-acyltransferase|3-ketoacyl-coa thiolase}}
 
−
{{#set: ec-number=ec-2.3.1.16}}
 
−
{{#set: nb gene associated=5}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9866

  • common-name:
    • 2-methoxy-6-(all-trans-nonaprenyl)phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
  • inchi-key:
    • xryxraoxvpwhhk-ssrazkmssa-n
  • molecular-weight:
    • 737.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9866&oldid=139706"