Difference between revisions of "CPD-9867"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12692 == * common-name: ** (2r)-3-sulfopropanediol * smiles: ** c(s(=o)(=o)[o-])c(o)co * inchi-key: ** ypfujzaazjxmip-gsvougtgsa-m *...") |
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-7417 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cis-coumarinic acid-β-d-glucoside |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gvriyimnjgulcz-qlfwqtqqsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 325.294 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8036]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cis-coumarinic acid-β-d-glucoside}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=325.294}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-7417
- common-name:
- cis-coumarinic acid-β-d-glucoside
- smiles:
- c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
- inchi-key:
- gvriyimnjgulcz-qlfwqtqqsa-m
- molecular-weight:
- 325.294
