Difference between revisions of "CPD-9867"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-21 == * common-name: ** leukotriene-d4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite CPD-9867 == * common-name: ** 3-(all-trans-decaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD66-21 ==
+
== Metabolite CPD-9867 ==
 
* common-name:
 
* common-name:
** leukotriene-d4
+
** 3-(all-trans-decaprenyl)benzene-1,2-diol
 
* smiles:
 
* smiles:
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** yeeskjgwjfyook-ijhyuljssa-m
+
** caujtfnfoamxrt-xrbhbmlssa-n
 
* molecular-weight:
 
* molecular-weight:
** 495.653
+
** 791.294
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9233]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-336]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=leukotriene-d4}}
+
{{#set: common-name=3-(all-trans-decaprenyl)benzene-1,2-diol}}
{{#set: inchi-key=inchikey=yeeskjgwjfyook-ijhyuljssa-m}}
+
{{#set: inchi-key=inchikey=caujtfnfoamxrt-xrbhbmlssa-n}}
{{#set: molecular-weight=495.653}}
+
{{#set: molecular-weight=791.294}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-9867

  • common-name:
    • 3-(all-trans-decaprenyl)benzene-1,2-diol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • caujtfnfoamxrt-xrbhbmlssa-n
  • molecular-weight:
    • 791.294

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality