Difference between revisions of "CPD-9867"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACYL-COA == * common-name: ** an acyl-coa == Reaction(s) known to consume the compound == * 2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN * ...")
(Created page with "Category:metabolite == Metabolite CPD-9867 == * common-name: ** 3-(all-trans-decaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACYL-COA ==
+
== Metabolite CPD-9867 ==
 
* common-name:
 
* common-name:
** an acyl-coa
+
** 3-(all-trans-decaprenyl)benzene-1,2-diol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** caujtfnfoamxrt-xrbhbmlssa-n
 +
* molecular-weight:
 +
** 791.294
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+
* [[RXN-9233]]
* [[2.3.1.23-RXN]]
 
* [[ACYL-COA-HYDROLASE-RXN]]
 
* [[ACYL-COA-OXIDASE-RXN]]
 
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
 
* [[PLASMALOGEN-SYNTHASE-RXN]]
 
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 
* [[RXN-13112]]
 
* [[RXN-1381]]
 
* [[RXN-1623]]
 
* [[RXN-17729]]
 
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
 
* [[2.3.1.23-RXN]]
 
* [[BUTYRATE--COA-LIGASE-RXN]]
 
* [[PLASMALOGEN-SYNTHASE-RXN]]
 
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 
* [[RXN-13112]]
 
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an acyl-coa}}
+
{{#set: common-name=3-(all-trans-decaprenyl)benzene-1,2-diol}}
 +
{{#set: inchi-key=inchikey=caujtfnfoamxrt-xrbhbmlssa-n}}
 +
{{#set: molecular-weight=791.294}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-9867

  • common-name:
    • 3-(all-trans-decaprenyl)benzene-1,2-diol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • caujtfnfoamxrt-xrbhbmlssa-n
  • molecular-weight:
    • 791.294

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality