Difference between revisions of "CPD-9868"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Dietary-retinyl-esters == * common-name: ** a dietary all-trans-retinyl ester == Reaction(s) known to consume the compound == * RXN-125...")
(Created page with "Category:metabolite == Metabolite CPD-9868 == * common-name: ** 3-(all-trans-nonaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Dietary-retinyl-esters ==
+
== Metabolite CPD-9868 ==
 
* common-name:
 
* common-name:
** a dietary all-trans-retinyl ester
+
** 3-(all-trans-nonaprenyl)benzene-1,2-diol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** pkyzmvivzpjxfm-xbvqzqhusa-n
 +
* molecular-weight:
 +
** 723.176
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12579]]
+
* [[RXN-9240]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a dietary all-trans-retinyl ester}}
+
{{#set: common-name=3-(all-trans-nonaprenyl)benzene-1,2-diol}}
 +
{{#set: inchi-key=inchikey=pkyzmvivzpjxfm-xbvqzqhusa-n}}
 +
{{#set: molecular-weight=723.176}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-9868

  • common-name:
    • 3-(all-trans-nonaprenyl)benzene-1,2-diol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c
  • inchi-key:
    • pkyzmvivzpjxfm-xbvqzqhusa-n
  • molecular-weight:
    • 723.176

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality