Difference between revisions of "CPD-9868"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05913 == * transcription-direction: ** positive * right-end-position: ** 85665 * left-end-position: ** 60363 * centisome-position: ** 69.88561...") |
(Created page with "Category:metabolite == Metabolite CPD-9868 == * common-name: ** 3-(all-trans-nonaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-9868 == |
− | * | + | * common-name: |
− | ** | + | ** 3-(all-trans-nonaprenyl)benzene-1,2-diol |
− | + | * smiles: | |
− | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c | |
− | + | * inchi-key: | |
− | + | ** pkyzmvivzpjxfm-xbvqzqhusa-n | |
− | * | + | * molecular-weight: |
− | ** | + | ** 723.176 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-9240]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=3-(all-trans-nonaprenyl)benzene-1,2-diol}} | |
− | ** | + | {{#set: inchi-key=inchikey=pkyzmvivzpjxfm-xbvqzqhusa-n}} |
− | + | {{#set: molecular-weight=723.176}} | |
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-9868
- common-name:
- 3-(all-trans-nonaprenyl)benzene-1,2-diol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c
- inchi-key:
- pkyzmvivzpjxfm-xbvqzqhusa-n
- molecular-weight:
- 723.176