Difference between revisions of "CPD-9868"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15172 == * common-name: ** 6,7-dehydrobaicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3))) * inchi-key: ** ls...") |
(Created page with "Category:metabolite == Metabolite Dietary-retinyl-esters == * common-name: ** a dietary all-trans-retinyl ester == Reaction(s) known to consume the compound == * RXN-125...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Dietary-retinyl-esters == |
* common-name: | * common-name: | ||
− | ** | + | ** a dietary all-trans-retinyl ester |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12579]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a dietary all-trans-retinyl ester}} |
− | |||
− |
Revision as of 14:55, 5 January 2021
Contents
Metabolite Dietary-retinyl-esters
- common-name:
- a dietary all-trans-retinyl ester