Difference between revisions of "CPD-9868"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LIPOAMIDE == * common-name: ** lipoamide * smiles: ** c1(cc(ccccc(n)=o)ss1) * inchi-key: ** fccddurtiiuxby-ssdottswsa-n * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite CPD-11402 == * common-name: ** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide * smiles: ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11402 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide |
* smiles: | * smiles: | ||
| − | ** c1(cc( | + | ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c=c3))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lqmbvwcqwfepfk-dkbymcrtsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 826.095 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-10609]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lqmbvwcqwfepfk-dkbymcrtsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=826.095}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-11402
- common-name:
- 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide
- smiles:
- c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c=c3)))
- inchi-key:
- lqmbvwcqwfepfk-dkbymcrtsa-m
- molecular-weight:
- 826.095
