Difference between revisions of "CPD-9869"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Glutamine-synthetase-Tyr == * common-name: ** a [glutamine-synthetase]-l-tyrosine == Reaction(s) known to consume the compound == * GSA...")
(Created page with "Category:metabolite == Metabolite CPD-9869 == * common-name: ** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Glutamine-synthetase-Tyr ==
+
== Metabolite CPD-9869 ==
 
* common-name:
 
* common-name:
** a [glutamine-synthetase]-l-tyrosine
+
** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** lioknoijmjkvcg-rdsvhmiisa-n
 +
* molecular-weight:
 +
** 821.32
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GSADENYLATION-RXN]]
+
* [[RXN-9235]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glutamine-synthetase]-l-tyrosine}}
+
{{#set: common-name=all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol}}
 +
{{#set: inchi-key=inchikey=lioknoijmjkvcg-rdsvhmiisa-n}}
 +
{{#set: molecular-weight=821.32}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-9869

  • common-name:
    • all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • lioknoijmjkvcg-rdsvhmiisa-n
  • molecular-weight:
    • 821.32

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality