Difference between revisions of "CPD-9869"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09895 == * transcription-direction: ** negative * right-end-position: ** 223877 * left-end-position: ** 210318 * centisome-position: ** 51.997776...") |
(Created page with "Category:metabolite == Metabolite CPD-9869 == * common-name: ** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-9869 == |
| − | * | + | * common-name: |
| − | ** | + | ** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol |
| − | + | * smiles: | |
| − | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c)c | |
| − | + | * inchi-key: | |
| − | * | + | ** lioknoijmjkvcg-rdsvhmiisa-n |
| − | + | * molecular-weight: | |
| − | ** | + | ** 821.32 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-9235]] | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol}} | |
| − | ** | + | {{#set: inchi-key=inchikey=lioknoijmjkvcg-rdsvhmiisa-n}} |
| − | * | + | {{#set: molecular-weight=821.32}} |
| − | |||
| − | ** | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-9869
- common-name:
- all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c)c
- inchi-key:
- lioknoijmjkvcg-rdsvhmiisa-n
- molecular-weight:
- 821.32
