Difference between revisions of "CPD-9870"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03414 == * transcription-direction: ** negative * right-end-position: ** 27898 * left-end-position: ** 6761 * centisome-position: ** 5.574198 =...")
(Created page with "Category:metabolite == Metabolite CPD-9870 == * common-name: ** 2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ03414 ==
+
== Metabolite CPD-9870 ==
* transcription-direction:
+
* common-name:
** negative
+
** 2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol
* right-end-position:
+
* smiles:
** 27898
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c
* left-end-position:
+
* inchi-key:
** 6761
+
** skaoreknlokwtc-jsgwljpksa-n
* centisome-position:
+
* molecular-weight:
** 5.574198   
+
** 753.202
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-9242]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=skaoreknlokwtc-jsgwljpksa-n}}
{{#set: transcription-direction=negative}}
+
{{#set: molecular-weight=753.202}}
{{#set: right-end-position=27898}}
 
{{#set: left-end-position=6761}}
 
{{#set: centisome-position=5.574198    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-9870

  • common-name:
    • 2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c
  • inchi-key:
    • skaoreknlokwtc-jsgwljpksa-n
  • molecular-weight:
    • 753.202

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality