Difference between revisions of "CPD-9871"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2338 == * common-name: ** (z)-3-ureidoacrylate peracid * smiles: ** c(nc(n)=o)=cc(=o)oo * inchi-key: ** ajfkxwqdhfykfk-uphrsurjsa-n...")
(Created page with "Category:metabolite == Metabolite CPD-9871 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2338 ==
+
== Metabolite CPD-9871 ==
 
* common-name:
 
* common-name:
** (z)-3-ureidoacrylate peracid
+
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** c(nc(n)=o)=cc(=o)oo
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** ajfkxwqdhfykfk-uphrsurjsa-n
+
** xcoxsblqzpfvgk-rgiwonjesa-n
 
* molecular-weight:
 
* molecular-weight:
** 146.102
+
** 835.347
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12894]]
 
* [[RXN0-6460]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9235]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(z)-3-ureidoacrylate peracid}}
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=ajfkxwqdhfykfk-uphrsurjsa-n}}
+
{{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}}
{{#set: molecular-weight=146.102}}
+
{{#set: molecular-weight=835.347}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-9871

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • xcoxsblqzpfvgk-rgiwonjesa-n
  • molecular-weight:
    • 835.347

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality