Difference between revisions of "CPD-9871"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BRANCHED-CHAINAMINOTRANSFERVAL-RXN BRANCHED-CHAINAMINOTRANSFERVAL-RXN] == * direction: ** reversibl...") |
(Created page with "Category:metabolite == Metabolite CPD-9871 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-9871 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c |
− | == | + | * inchi-key: |
− | + | ** xcoxsblqzpfvgk-rgiwonjesa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 835.347 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9235]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}} | |
− | + | {{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}} | |
− | + | {{#set: molecular-weight=835.347}} | |
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-9871
- common-name:
- 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
- inchi-key:
- xcoxsblqzpfvgk-rgiwonjesa-n
- molecular-weight:
- 835.347