|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BRANCHED-CHAINAMINOTRANSFERVAL-RXN BRANCHED-CHAINAMINOTRANSFERVAL-RXN] == | + | == Metabolite CPD-9871 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** valine transaminase | + | ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.6.1.42 ec-2.6.1.42] | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[VAL]][c] '''<=>''' 1 [[2-KETO-ISOVALERATE]][c] '''+''' 1 [[GLT]][c]
| + | ** xcoxsblqzpfvgk-rgiwonjesa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ17677]] | + | ** 835.347 |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ06412]]
| + | * [[RXN-9235]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: molecular-weight=835.347}} |
| − | * Gene: [[SJ04586]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[VALDEG-PWY]], L-valine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY]
| |
| − | ** '''6''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[VALSYN-PWY]], L-valine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=VALSYN-PWY VALSYN-PWY]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[ALANINE-VALINESYN-PWY]], L-alanine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-VALINESYN-PWY ALANINE-VALINESYN-PWY]
| |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-5057]], L-valine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5057 PWY-5057] | |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24816 24816]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01214 R01214]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PIM6 Q9PIM6]
| |
| − | ** [http://www.uniprot.org/uniprot/P38891 P38891]
| |
| − | ** [http://www.uniprot.org/uniprot/P47176 P47176]
| |
| − | ** [http://www.uniprot.org/uniprot/O86505 O86505]
| |
| − | ** [http://www.uniprot.org/uniprot/O14370 O14370]
| |
| − | ** [http://www.uniprot.org/uniprot/O32954 O32954]
| |
| − | ** [http://www.uniprot.org/uniprot/P0AB80 P0AB80]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=valine transaminase}} | |
| − | {{#set: ec-number=ec-2.6.1.42}}
| |
| − | {{#set: nb gene associated=3}}
| |
| − | {{#set: nb pathway associated=4}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}} | |
