Difference between revisions of "CPD-9871"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05673 == * transcription-direction: ** negative * right-end-position: ** 60946 * left-end-position: ** 54941 * centisome-position: ** 11.144467...")
(Created page with "Category:metabolite == Metabolite CPD-9871 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ05673 ==
+
== Metabolite CPD-9871 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
−
* right-end-position:
+
* smiles:
−
** 60946
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
−
* left-end-position:
+
* inchi-key:
−
** 54941
+
** xcoxsblqzpfvgk-rgiwonjesa-n
−
* centisome-position:
+
* molecular-weight:
−
** 11.144467   
+
** 835.347
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-9235]]
−
* [[RXN-12615]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}}
−
* [[RXN-7682]]
+
{{#set: molecular-weight=835.347}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-901]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[XANTHINE-OXIDASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[PWY-6596]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
* [[P164-PWY]]
 
−
** '''6''' reactions found over '''17''' reactions in the full pathway
 
−
* [[SALVADEHYPOX-PWY]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5497]]
 
−
** '''10''' reactions found over '''24''' reactions in the full pathway
 
−
* [[PWY-6606]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6607]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6999]]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6608]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6538]]
 
−
** '''2''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-5695]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=60946}}
 
−
{{#set: left-end-position=54941}}
 
−
{{#set: centisome-position=11.144467    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=10}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-9871

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • xcoxsblqzpfvgk-rgiwonjesa-n
  • molecular-weight:
    • 835.347

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9871&oldid=138345"