Difference between revisions of "CPD-9872"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17280 == * common-name: ** a [glycerolipid]-((9z,12z)-octadecadien-6-ynoate == Reaction(s) known to consume the compound == == Reacti...")
(Created page with "Category:metabolite == Metabolite MALTOPENTAOSE == * common-name: ** maltopentaose * smiles: ** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17280 ==
+
== Metabolite MALTOPENTAOSE ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-((9z,12z)-octadecadien-6-ynoate
+
** maltopentaose
 +
* smiles:
 +
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
 +
* inchi-key:
 +
** ftnipwxxignqqf-hzwihctqsa-n
 +
* molecular-weight:
 +
** 828.725
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14281]]
 +
* [[RXN-14284]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11681]]
+
* [[RXN-14282]]
 +
* [[RXN-14285]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-((9z,12z)-octadecadien-6-ynoate}}
+
{{#set: common-name=maltopentaose}}
 +
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
 +
{{#set: molecular-weight=828.725}}

Revision as of 11:15, 15 January 2021

Metabolite MALTOPENTAOSE

  • common-name:
    • maltopentaose
  • smiles:
    • c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
  • inchi-key:
    • ftnipwxxignqqf-hzwihctqsa-n
  • molecular-weight:
    • 828.725

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality