Difference between revisions of "CPD-9894"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o * inchi-key:...")
(Created page with "Category:metabolite == Metabolite CPD-9894 == * common-name: ** 3,4-dihydroxy-5-all-trans-octaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOTRIOSE ==
+
== Metabolite CPD-9894 ==
 
* common-name:
 
* common-name:
** maltotriose
+
** 3,4-dihydroxy-5-all-trans-octaprenylbenzoate
 
* smiles:
 
* smiles:
** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** fygdtmlnykfzsv-dzoucchmsa-n
+
** ztgcmypriiaxfd-lhsbzcsksa-m
 
* molecular-weight:
 
* molecular-weight:
** 504.441
+
** 698.06
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5183]]
+
* [[RXN-9280]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5182]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltotriose}}
+
{{#set: common-name=3,4-dihydroxy-5-all-trans-octaprenylbenzoate}}
{{#set: inchi-key=inchikey=fygdtmlnykfzsv-dzoucchmsa-n}}
+
{{#set: inchi-key=inchikey=ztgcmypriiaxfd-lhsbzcsksa-m}}
{{#set: molecular-weight=504.441}}
+
{{#set: molecular-weight=698.06}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9894

  • common-name:
    • 3,4-dihydroxy-5-all-trans-octaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • ztgcmypriiaxfd-lhsbzcsksa-m
  • molecular-weight:
    • 698.06

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality