Difference between revisions of "CPD-9894"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.79-RXN 2.1.1.79-RXN] == * direction: ** left-to-right * common-name: ** cyclopropane fatty ac...")
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o * inchi-key:...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.79-RXN 2.1.1.79-RXN] ==
+
== Metabolite MALTOTRIOSE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** cyclopropane fatty acyl phospholipid synthase
+
** maltotriose
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.79 ec-2.1.1.79]
+
** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
== Reaction formula ==
+
* inchi-key:
* 1 [[Phospholipid-Olefinic-Fatty-Acids]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Phospholipid-Cyclopropane-Fatty-Acids]][c]
+
** fygdtmlnykfzsv-dzoucchmsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ13641]]
+
** 504.441
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-5183]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN0-5182]]
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
* [[PWY0-541]], cyclopropane fatty acid (CFA) biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-541 PWY0-541]
+
{{#set: common-name=maltotriose}}
** '''1''' reactions found over '''1''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=fygdtmlnykfzsv-dzoucchmsa-n}}
== Reconstruction information  ==
+
{{#set: molecular-weight=504.441}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11989 11989]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R03411 R03411]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P0A9H7 P0A9H7]
 
** [http://www.uniprot.org/uniprot/O69687 O69687]
 
** [http://www.uniprot.org/uniprot/Q9PNB2 Q9PNB2]
 
** [http://www.uniprot.org/uniprot/Q9ZKG8 Q9ZKG8]
 
** [http://www.uniprot.org/uniprot/O67624 O67624]
 
** [http://www.uniprot.org/uniprot/O25171 O25171]
 
** [http://www.uniprot.org/uniprot/O53732 O53732]
 
** [http://www.uniprot.org/uniprot/Q9XTE1 Q9XTE1]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=cyclopropane fatty acyl phospholipid synthase}}
 
{{#set: ec-number=ec-2.1.1.79}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite MALTOTRIOSE

  • common-name:
    • maltotriose
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
  • inchi-key:
    • fygdtmlnykfzsv-dzoucchmsa-n
  • molecular-weight:
    • 504.441

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality