Difference between revisions of "CPD-9895"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-ETCETERA-L-ASPARAGINE == * common-name: ** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc...")
(Created page with "Category:metabolite == Metabolite FORMATE == * common-name: ** formate * smiles: ** [ch]([o-])=o * inchi-key: ** bdagihxwwsansr-uhfffaoysa-m * molecular-weight: ** 45.018...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETYL-ETCETERA-L-ASPARAGINE ==
+
== Metabolite FORMATE ==
 
* common-name:
 
* common-name:
** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine
+
** formate
 
* smiles:
 
* smiles:
** cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1)
+
** [ch]([o-])=o
 
* inchi-key:
 
* inchi-key:
** yttrpbwemmpysw-hrrfrdkfsa-n
+
** bdagihxwwsansr-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 335.313
+
** 45.018
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.5.1.26-RXN]]
+
* [[1.2.1.2-RXN]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[FORthi]]
 +
* [[FTHFL]]
 +
* [[RXN0-723]]
 +
* [[RXN0-724]]
 +
* [[RXN0-745]]
 +
* [[RXN0-746]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.14.13.70-RXN]]
 +
* [[1.2.1.2-RXN]]
 +
* [[3.5.1.27-RXN]]
 +
* [[3.5.1.88-RXN]]
 +
* [[ARYLFORMAMIDASE-RXN]]
 +
* [[DIOHBUTANONEPSYN-RXN]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[FORMYLTHFDEFORMYL-RXN]]
 +
* [[FORthi]]
 +
* [[FTHDF]]
 +
* [[GTP-CYCLOHYDRO-I-RXN]]
 +
* [[GTP-CYCLOHYDRO-II-RXN]]
 +
* [[OXALATE-DECARBOXYLASE-RXN]]
 +
* [[PYRIMSYN1-RXN]]
 +
* [[R147-RXN]]
 +
* [[RXN-11881]]
 +
* [[RXN-13707]]
 +
* [[RXN-13868]]
 +
* [[RXN-13961]]
 +
* [[RXN-17150]]
 +
* [[RXN3O-130]]
 +
* [[RXN66-13]]
 +
* [[RXN66-305]]
 +
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n4-(&beta;-n-acetyl-d-glucosaminyl)-l-asparagine}}
+
{{#set: common-name=formate}}
{{#set: inchi-key=inchikey=yttrpbwemmpysw-hrrfrdkfsa-n}}
+
{{#set: inchi-key=inchikey=bdagihxwwsansr-uhfffaoysa-m}}
{{#set: molecular-weight=335.313}}
+
{{#set: molecular-weight=45.018}}

Revision as of 11:16, 15 January 2021