Difference between revisions of "CPD-9895"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12115 == * common-name: ** demethylmenaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o...")
(Created page with "Category:metabolite == Metabolite CPD-9895 == * common-name: ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12115 ==
+
== Metabolite CPD-9895 ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-8
+
** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** fgypgicsxjekcg-aendiincsa-n
+
** hgwugdiatlopbn-bhzqgfrmsa-m
 
* molecular-weight:
 
* molecular-weight:
** 705.118
+
** 834.296
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
+
* [[RXN-9282]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-8}}
+
{{#set: common-name=3,4-dihydroxy-5-all-trans-decaprenylbenzoate}}
{{#set: inchi-key=inchikey=fgypgicsxjekcg-aendiincsa-n}}
+
{{#set: inchi-key=inchikey=hgwugdiatlopbn-bhzqgfrmsa-m}}
{{#set: molecular-weight=705.118}}
+
{{#set: molecular-weight=834.296}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-9895

  • common-name:
    • 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • hgwugdiatlopbn-bhzqgfrmsa-m
  • molecular-weight:
    • 834.296

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality