Difference between revisions of "CPD-9895"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BENZALDEHYDE == * common-name: ** benzaldehyde * smiles: ** c(=o)c1(=cc=cc=c1) * inchi-key: ** humnylrzrppjdn-uhfffaoysa-n * molecular-we...") |
(Created page with "Category:metabolite == Metabolite CPD-9895 == * common-name: ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9895 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate |
* smiles: | * smiles: | ||
− | ** c(=o) | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hgwugdiatlopbn-bhzqgfrmsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 834.296 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9282]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxy-5-all-trans-decaprenylbenzoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hgwugdiatlopbn-bhzqgfrmsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=834.296}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-9895
- common-name:
- 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c
- inchi-key:
- hgwugdiatlopbn-bhzqgfrmsa-m
- molecular-weight:
- 834.296