Difference between revisions of "CPD-9895"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01352 == * transcription-direction: ** negative * right-end-position: ** 21918 * left-end-position: ** 18475 * centisome-position: ** 12.137996...")
 
(Created page with "Category:metabolite == Metabolite CPD-9895 == * common-name: ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ01352 ==
+
== Metabolite CPD-9895 ==
* transcription-direction:
+
* common-name:
** negative
+
** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
* right-end-position:
+
* smiles:
** 21918
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c
* left-end-position:
+
* inchi-key:
** 18475
+
** hgwugdiatlopbn-bhzqgfrmsa-m
* centisome-position:
+
* molecular-weight:
** 12.137996   
+
** 834.296
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-9282]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=3,4-dihydroxy-5-all-trans-decaprenylbenzoate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hgwugdiatlopbn-bhzqgfrmsa-m}}
** Category: [[orthology]]
+
{{#set: molecular-weight=834.296}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=21918}}
 
{{#set: left-end-position=18475}}
 
{{#set: centisome-position=12.137996    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-9895

  • common-name:
    • 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • hgwugdiatlopbn-bhzqgfrmsa-m
  • molecular-weight:
    • 834.296

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality