Difference between revisions of "CPD-9896"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8355 == * common-name: ** 1-18:1-2-lysophosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o * inch...")
(Created page with "Category:metabolite == Metabolite MANNOSE == * common-name: ** d-mannose == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8355 ==
+
== Metabolite MANNOSE ==
 
* common-name:
 
* common-name:
** 1-18:1-2-lysophosphatidylethanolamine
+
** d-mannose
* smiles:
 
** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
 
* inchi-key:
 
** pyvrvrfvlrnjly-mzmpxxgtsa-n
 
* molecular-weight:
 
** 479.593
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15035]]
 
* [[RXN-15036]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15036]]
+
* [[3.2.1.113-RXN]]
* [[RXN-15067]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:1-2-lysophosphatidylethanolamine}}
+
{{#set: common-name=d-mannose}}
{{#set: inchi-key=inchikey=pyvrvrfvlrnjly-mzmpxxgtsa-n}}
 
{{#set: molecular-weight=479.593}}
 

Revision as of 08:26, 15 March 2021

Metabolite MANNOSE

  • common-name:
    • d-mannose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality