Difference between revisions of "CPD-9896"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8355 == * common-name: ** 1-18:1-2-lysophosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o * inch...") |
(Created page with "Category:metabolite == Metabolite MANNOSE == * common-name: ** d-mannose == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MANNOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** d-mannose |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.2.1.113-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-mannose}} |
− | |||
− |
Revision as of 08:26, 15 March 2021
Contents
Metabolite MANNOSE
- common-name:
- d-mannose