Difference between revisions of "CPD-9896"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CHLOROPHYLL-B == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=...")
(Created page with "Category:metabolite == Metabolite CPD-9896 == * common-name: ** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CHLOROPHYLL-B ==
+
== Metabolite CPD-9896 ==
 +
* common-name:
 +
** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)c(c(oc)=o)c5=c(n67)8)))))9))))
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
* common-name:
+
* inchi-key:
** chlorophyll b
+
** fmsczymouyoenk-opsrswoasa-m
 
* molecular-weight:
 
* molecular-weight:
** 907.486
+
** 766.178
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9281]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7674]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=chlorophyll b}}
+
{{#set: common-name=3,4-dihydroxy-5-all-trans-nonaprenylbenzoate}}
{{#set: molecular-weight=907.486}}
+
{{#set: inchi-key=inchikey=fmsczymouyoenk-opsrswoasa-m}}
 +
{{#set: molecular-weight=766.178}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-9896

  • common-name:
    • 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • fmsczymouyoenk-opsrswoasa-m
  • molecular-weight:
    • 766.178

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality