Difference between revisions of "CPD-9896"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03828 == * transcription-direction: ** negative * right-end-position: ** 65111 * left-end-position: ** 45355 * centisome-position: ** 39.29187...") |
(Created page with "Category:metabolite == Metabolite CPD-9896 == * common-name: ** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-9896 == |
− | * | + | * common-name: |
− | ** | + | ** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate |
− | + | * smiles: | |
− | + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c | |
− | + | * inchi-key: | |
− | * | + | ** fmsczymouyoenk-opsrswoasa-m |
− | + | * molecular-weight: | |
− | ** | + | ** 766.178 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-9281]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=3,4-dihydroxy-5-all-trans-nonaprenylbenzoate}} |
− | + | {{#set: inchi-key=inchikey=fmsczymouyoenk-opsrswoasa-m}} | |
− | + | {{#set: molecular-weight=766.178}} | |
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-9896
- common-name:
- 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
- inchi-key:
- fmsczymouyoenk-opsrswoasa-m
- molecular-weight:
- 766.178