Difference between revisions of "CPD-9896"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite CPD-9896 == * common-name: ** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DUTP ==
+
== Metabolite CPD-9896 ==
 
* common-name:
 
* common-name:
** dutp
+
** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
 
* smiles:
 
* smiles:
** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** ahcymluzirlxaa-shyzeuofsa-j
+
** fmsczymouyoenk-opsrswoasa-m
 
* molecular-weight:
 
* molecular-weight:
** 464.112
+
** 766.178
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DUTCP]]
+
* [[RXN-9281]]
* [[DUTNH]]
 
* [[DUTP-PYROP-RXN]]
 
* [[DUTUP]]
 
* [[RXN-14199]]
 
* [[RXN-14219]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATDUD]]
 
* [[ATDUDm]]
 
* [[DUDPKIN-RXN]]
 
* [[RXN0-724]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dutp}}
+
{{#set: common-name=3,4-dihydroxy-5-all-trans-nonaprenylbenzoate}}
{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
+
{{#set: inchi-key=inchikey=fmsczymouyoenk-opsrswoasa-m}}
{{#set: molecular-weight=464.112}}
+
{{#set: molecular-weight=766.178}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-9896

  • common-name:
    • 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • fmsczymouyoenk-opsrswoasa-m
  • molecular-weight:
    • 766.178

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality