Difference between revisions of "CPD-9896"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-FERULIC-ACID == * common-name: ** 5-hydroxyferulate * smiles: ** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1) * inchi-key: ** yfxwtvldsk...") |
(Created page with "Category:metabolite == Metabolite CHLOROPHYLL-B == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CHLOROPHYLL-B == |
+ | * smiles: | ||
+ | ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)c(c(oc)=o)c5=c(n67)8)))))9)))) | ||
* common-name: | * common-name: | ||
− | ** | + | ** chlorophyll b |
− | |||
− | |||
− | |||
− | |||
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 907.486 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-7674]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=chlorophyll b}} |
− | + | {{#set: molecular-weight=907.486}} | |
− | {{#set: molecular-weight= |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CHLOROPHYLL-B
- smiles:
- c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)c(c(oc)=o)c5=c(n67)8)))))9))))
- common-name:
- chlorophyll b
- molecular-weight:
- 907.486