Difference between revisions of "CPD-9896"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-FERULIC-ACID == * common-name: ** 5-hydroxyferulate * smiles: ** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1) * inchi-key: ** yfxwtvldsk...")
(Created page with "Category:metabolite == Metabolite CHLOROPHYLL-B == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-HYDROXY-FERULIC-ACID ==
+
== Metabolite CHLOROPHYLL-B ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)c(c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** 5-hydroxyferulate
+
** chlorophyll b
* smiles:
 
** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1)
 
* inchi-key:
 
** yfxwtvldsksylw-nscuhmnnsa-m
 
 
* molecular-weight:
 
* molecular-weight:
** 209.178
+
** 907.486
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-3422]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1121]]
+
* [[RXN-7674]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxyferulate}}
+
{{#set: common-name=chlorophyll b}}
{{#set: inchi-key=inchikey=yfxwtvldsksylw-nscuhmnnsa-m}}
+
{{#set: molecular-weight=907.486}}
{{#set: molecular-weight=209.178}}
 

Revision as of 14:55, 5 January 2021

Metabolite CHLOROPHYLL-B

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)c(c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • chlorophyll b
  • molecular-weight:
    • 907.486

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality