Difference between revisions of "CPD-9896"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17716 == * transcription-direction: ** negative * right-end-position: ** 3396 * left-end-position: ** 531 * centisome-position: ** 14.709142 ==...")
(Created page with "Category:metabolite == Metabolite CPD-9896 == * common-name: ** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17716 ==
+
== Metabolite CPD-9896 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
−
* right-end-position:
+
* smiles:
−
** 3396
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
−
* left-end-position:
+
* inchi-key:
−
** 531
+
** fmsczymouyoenk-opsrswoasa-m
−
* centisome-position:
+
* molecular-weight:
−
** 14.709142   
+
** 766.178
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-9281]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=3,4-dihydroxy-5-all-trans-nonaprenylbenzoate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=fmsczymouyoenk-opsrswoasa-m}}
−
* [[RXN66-579]]
+
{{#set: molecular-weight=766.178}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-4661]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6372]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-2301]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6664]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6580]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY1G-0]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=3396}}
 
−
{{#set: left-end-position=531}}
 
−
{{#set: centisome-position=14.709142    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-9896

  • common-name:
    • 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • fmsczymouyoenk-opsrswoasa-m
  • molecular-weight:
    • 766.178

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9896&oldid=137560"