|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHAGLYPSYN-RXN PHOSPHAGLYPSYN-RXN] == | + | == Metabolite CPD-9897 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** cdp-diacylglycerol-glycerol-3-phosphate 3-phosphatidyltransferase | + | ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.8.5 ec-2.7.8.5] | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[CDPDIACYLGLYCEROL]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[CMP]][c] '''+''' 1 [[L-1-PHOSPHATIDYL-GLYCEROL-P]][c] '''+''' 1 [[PROTON]][c]
| + | ** wcqcnoikxgndlx-rdsvhmiisa-m |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ08733]] | + | ** 848.323 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]]
| + | * [[RXN-9282]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate}} |
| − | == Pathway(s) == | + | {{#set: inchi-key=inchikey=wcqcnoikxgndlx-rdsvhmiisa-m}} |
| − | * [[PWY-5269]], cardiolipin biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5269 PWY-5269]
| + | {{#set: molecular-weight=848.323}} |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY0-1545]], cardiolipin biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1545 PWY0-1545]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-5668]], cardiolipin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5668 PWY-5668]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY4FS-8]], phosphatidylglycerol biosynthesis II (non-plastidic): [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-8 PWY4FS-8]
| |
| − | ** '''3''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY4FS-7]], phosphatidylglycerol biosynthesis I (plastidic): [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-7 PWY4FS-7]
| |
| − | ** '''3''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7817]], type I lipoteichoic acid biosynthesis (S. aureus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7817 PWY-7817]
| |
| − | ** '''6''' reactions found over '''16''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12593 12593]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01801 R01801]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JTH1 Q9JTH1]
| |
| − | ** [http://www.uniprot.org/uniprot/P46322 P46322]
| |
| − | ** [http://www.uniprot.org/uniprot/P44528 P44528]
| |
| − | ** [http://www.uniprot.org/uniprot/P47360 P47360]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PNM7 Q9PNM7]
| |
| − | ** [http://www.uniprot.org/uniprot/O25660 O25660]
| |
| − | ** [http://www.uniprot.org/uniprot/O51663 O51663]
| |
| − | ** [http://www.uniprot.org/uniprot/O67908 O67908]
| |
| − | ** [http://www.uniprot.org/uniprot/Q49839 Q49839]
| |
| − | ** [http://www.uniprot.org/uniprot/P75520 P75520]
| |
| − | ** [http://www.uniprot.org/uniprot/P74372 P74372]
| |
| − | ** [http://www.uniprot.org/uniprot/Q48959 Q48959]
| |
| − | ** [http://www.uniprot.org/uniprot/P0ABF8 P0ABF8]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=cdp-diacylglycerol-glycerol-3-phosphate 3-phosphatidyltransferase}} | |
| − | {{#set: ec-number=ec-2.7.8.5}}
| |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=6}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
| |
