Difference between revisions of "CPD-9897"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14037 RXN-14037] == * direction: ** reversible == Reaction formula == * 1 2-ACETO-LACTATE[c...") |
(Created page with "Category:metabolite == Metabolite CPD-9897 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-9897 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate |
| − | + | * smiles: | |
| − | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c | |
| − | == | + | * inchi-key: |
| − | == | + | ** wcqcnoikxgndlx-rdsvhmiisa-m |
| − | == | + | * molecular-weight: |
| − | + | ** 848.323 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | ** | + | * [[RXN-9282]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | ** | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate}} |
| − | + | {{#set: inchi-key=inchikey=wcqcnoikxgndlx-rdsvhmiisa-m}} | |
| − | + | {{#set: molecular-weight=848.323}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-9897
- common-name:
- 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c
- inchi-key:
- wcqcnoikxgndlx-rdsvhmiisa-m
- molecular-weight:
- 848.323
