Difference between revisions of "CPD-9897"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-OXOPROLINE == * common-name: ** 5-oxo-l-proline * smiles: ** c(=o)(c1(nc(cc1)=o))[o-] * inchi-key: ** odhctxknwhhxjc-vkhmyheasa-m * mol...") |
(Created page with "Category:metabolite == Metabolite CPD-9897 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9897 == |
* common-name: | * common-name: | ||
− | ** 5- | + | ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate |
* smiles: | * smiles: | ||
− | ** c(= | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wcqcnoikxgndlx-rdsvhmiisa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 848.323 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-9282]] | |
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=5- | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wcqcnoikxgndlx-rdsvhmiisa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=848.323}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-9897
- common-name:
- 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c
- inchi-key:
- wcqcnoikxgndlx-rdsvhmiisa-m
- molecular-weight:
- 848.323