Difference between revisions of "CPD-9897"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TREHALOSE-6P == * common-name: ** α,α-trehalose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite 5-OXOPROLINE == * common-name: ** 5-oxo-l-proline * smiles: ** c(=o)(c1(nc(cc1)=o))[o-] * inchi-key: ** odhctxknwhhxjc-vkhmyheasa-m * mol...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TREHALOSE-6P ==
+
== Metabolite 5-OXOPROLINE ==
 
* common-name:
 
* common-name:
** α,α-trehalose 6-phosphate
+
** 5-oxo-l-proline
 
* smiles:
 
* smiles:
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o
+
** c(=o)(c1(nc(cc1)=o))[o-]
 
* inchi-key:
 
* inchi-key:
** labspybhmpdtel-lizsdcnhsa-l
+
** odhctxknwhhxjc-vkhmyheasa-m
 
* molecular-weight:
 
* molecular-weight:
** 420.263
+
** 128.107
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TREHALOSEPHOSPHA-RXN]]
+
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TREHALOSE6PSYN-RXN]]
+
* [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]]
* [[UG6PGT]]
+
* [[RXN-15681]]
* [[UG6PGTn]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α,α-trehalose 6-phosphate}}
+
{{#set: common-name=5-oxo-l-proline}}
{{#set: inchi-key=inchikey=labspybhmpdtel-lizsdcnhsa-l}}
+
{{#set: inchi-key=inchikey=odhctxknwhhxjc-vkhmyheasa-m}}
{{#set: molecular-weight=420.263}}
+
{{#set: molecular-weight=128.107}}

Revision as of 13:11, 14 January 2021

Metabolite 5-OXOPROLINE

  • common-name:
    • 5-oxo-l-proline
  • smiles:
    • c(=o)(c1(nc(cc1)=o))[o-]
  • inchi-key:
    • odhctxknwhhxjc-vkhmyheasa-m
  • molecular-weight:
    • 128.107

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality