Difference between revisions of "CPD-9897"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.51-RXN 1.1.1.51-RXN] == * direction: ** left-to-right * common-name: ** testosterone dehydrog...")
(Created page with "Category:metabolite == Metabolite CPD-19150 == * common-name: ** (2e,5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.51-RXN 1.1.1.51-RXN] ==
+
== Metabolite CPD-19150 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** testosterone dehydrogenase [nad(p)]
+
** (2e,5z)-dodecenoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.51 ec-1.1.1.51]
+
** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[TESTOSTERONE]][c] '''=>''' 1 [[ANDROST4ENE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c]
+
** zsjrxhrcabosnc-shjpognxsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ01444]]
+
** 941.776
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-17797]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-6943]], testosterone and androsterone degradation to androstendione: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6943 PWY-6943]
+
* [[RXN-17796]]
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=(2e,5z)-dodecenoyl-coa}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=zsjrxhrcabosnc-shjpognxsa-j}}
−
== External links  ==
+
{{#set: molecular-weight=941.776}}
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14930 14930]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q7LZT0 Q7LZT0]
 
−
** [http://www.uniprot.org/uniprot/P19871 P19871]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=testosterone dehydrogenase [nad(p)]}}
 
−
{{#set: ec-number=ec-1.1.1.51}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-19150

  • common-name:
    • (2e,5z)-dodecenoyl-coa
  • smiles:
    • ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zsjrxhrcabosnc-shjpognxsa-j
  • molecular-weight:
    • 941.776

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9897&oldid=47364"