Difference between revisions of "CPD-9898"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Mannosyl9-Nacetylglucosaminyl2 == == Reaction(s) known to consume the compound == * 3.2.1.113-RXN == Reaction(s) known to produce the...") |
(Created page with "Category:metabolite == Metabolite CPD-9898 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9898 == |
+ | * common-name: | ||
+ | ** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate | ||
+ | * smiles: | ||
+ | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** fdppbyxdoxrdha-jsgwljpksa-m | ||
+ | * molecular-weight: | ||
+ | ** 780.205 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-9281]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate}} | ||
+ | {{#set: inchi-key=inchikey=fdppbyxdoxrdha-jsgwljpksa-m}} | ||
+ | {{#set: molecular-weight=780.205}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-9898
- common-name:
- 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
- inchi-key:
- fdppbyxdoxrdha-jsgwljpksa-m
- molecular-weight:
- 780.205