Difference between revisions of "CPD-9899"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA-DEHYDROGENASE-RXN GLUTARYL-COA-DEHYDROGENASE-RXN] == * direction: ** reversible * comm...")
(Created page with "Category:metabolite == Metabolite CPD-9899 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA-DEHYDROGENASE-RXN GLUTARYL-COA-DEHYDROGENASE-RXN] ==
+
== Metabolite CPD-9899 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** glutaryl-coa dehydrogenase
+
** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.8.6 ec-1.3.8.6]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ETF-Oxidized]][c] '''+''' 1 [[GLUTARYL-COA]][c] '''+''' 2 [[PROTON]][c] '''<=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CROTONYL-COA]][c] '''+''' 1 [[ETF-Reduced]][c]
+
** dzwhypvptjpqqx-mycgwmctsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07909]]
+
** 712.086
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-9280]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=dzwhypvptjpqqx-mycgwmctsa-m}}
−
* RHEA:
+
{{#set: molecular-weight=712.086}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13389 13389]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02488 R02488]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q92947 Q92947]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=glutaryl-coa dehydrogenase}}
 
−
{{#set: ec-number=ec-1.3.8.6}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-9899

  • common-name:
    • 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • dzwhypvptjpqqx-mycgwmctsa-m
  • molecular-weight:
    • 712.086

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9899&oldid=139788"