Difference between revisions of "CPD-9899"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7000 == * common-name: ** isobutanal * smiles: ** cc(c)[ch]=o * inchi-key: ** amimrnsirudhcm-uhfffaoysa-n * molecular-weight: ** 72.1...")
(Created page with "Category:metabolite == Metabolite CPD-9899 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7000 ==
+
== Metabolite CPD-9899 ==
 
* common-name:
 
* common-name:
** isobutanal
+
** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate
 
* smiles:
 
* smiles:
** cc(c)[ch]=o
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** amimrnsirudhcm-uhfffaoysa-n
+
** dzwhypvptjpqqx-mycgwmctsa-m
 
* molecular-weight:
 
* molecular-weight:
** 72.107
+
** 712.086
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7657]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7657]]
+
* [[RXN-9280]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isobutanal}}
+
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate}}
{{#set: inchi-key=inchikey=amimrnsirudhcm-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=dzwhypvptjpqqx-mycgwmctsa-m}}
{{#set: molecular-weight=72.107}}
+
{{#set: molecular-weight=712.086}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-9899

  • common-name:
    • 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • dzwhypvptjpqqx-mycgwmctsa-m
  • molecular-weight:
    • 712.086

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality