Difference between revisions of "CPD-9899"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5055 RXN0-5055] == * direction: ** left-to-right * common-name: ** acetyl-coa carboxyltransfer...")
 
(Created page with "Category:metabolite == Metabolite CPD-9899 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5055 RXN0-5055] ==
+
== Metabolite CPD-9899 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** acetyl-coa carboxyltransferase
+
** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.3.d ec-2.1.3.d]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
== Reaction formula ==
+
* inchi-key:
* 1 [[ACETYL-COA]][c] '''+''' 1 [[carboxybiotin-L-lysine-in-BCCP-dimers]][c] '''=>''' 1 [[MALONYL-COA]][c] '''+''' 1 [[biotin-L-lysine-in-BCCP-dimers]][c]
+
** dzwhypvptjpqqx-mycgwmctsa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 712.086
* Gene: [[SJ14528]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-9280]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate}}
* Gene: [[SJ17987]]
+
{{#set: inchi-key=inchikey=dzwhypvptjpqqx-mycgwmctsa-m}}
** Category: [[annotation]]
+
{{#set: molecular-weight=712.086}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ14529]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ06726]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ00484]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
* [[PWY-5744]], glyoxylate assimilation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5744 PWY-5744]
 
** '''4''' reactions found over '''13''' reactions in the full pathway
 
* [[PWY-5743]], 3-hydroxypropanoate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5743 PWY-5743]
 
** '''5''' reactions found over '''13''' reactions in the full pathway
 
* [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789]
 
** '''8''' reactions found over '''18''' reactions in the full pathway
 
* [[PWY0-1264]], biotin-carboxyl carrier protein assembly: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1264 PWY0-1264]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-6722]], candicidin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6722 PWY-6722]
 
** '''1''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY-4381]], fatty acid biosynthesis initiation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=acetyl-coa carboxyltransferase}}
 
{{#set: ec-number=ec-2.1.3.d}}
 
{{#set: nb gene associated=5}}
 
{{#set: nb pathway associated=6}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-9899

  • common-name:
    • 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • dzwhypvptjpqqx-mycgwmctsa-m
  • molecular-weight:
    • 712.086

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality