Difference between revisions of "CPD-9899"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-707 RXN-707] == * direction: ** left-to-right * common-name: ** 5-dehydroepisterol δ7 red...") |
(Created page with "Category:metabolite == Metabolite DGDP == * common-name: ** dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** cikg...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DGDP == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** dgdp |
− | * | + | * smiles: |
− | ** [ | + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
− | = | + | * inchi-key: |
− | + | ** cikgwctvfsrmju-kvqbguixsa-k | |
− | = | + | * molecular-weight: |
− | * | + | ** 424.18 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | *** | + | * [[ATDGD]] |
− | * | + | * [[DGDPKIN-RXN]] |
− | * | + | * [[DGTPtm]] |
− | == | + | * [[RXN-14207]] |
− | * [[ | + | * [[RXN-14218]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[ATDGM]] | |
− | + | * [[DGOTO]] | |
− | * | + | * [[DGTCY]] |
− | == | + | * [[DGTPtm]] |
− | + | * [[DGTUP]] | |
− | {{#set: common-name= | + | * [[GDPREDUCT-RXN]] |
− | {{#set: | + | * [[RXN-14217]] |
− | {{#set: | + | * [[RXN0-748]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=dgdp}} | |
− | + | {{#set: inchi-key=inchikey=cikgwctvfsrmju-kvqbguixsa-k}} | |
− | + | {{#set: molecular-weight=424.18}} | |
− |
Revision as of 20:38, 18 December 2020
Contents
Metabolite DGDP
- common-name:
- dgdp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- cikgwctvfsrmju-kvqbguixsa-k
- molecular-weight:
- 424.18