Difference between revisions of "CPD-9899"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DGDP == * common-name: ** dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** cikg...")
(Created page with "Category:metabolite == Metabolite Charged-fMET-tRNAs == * common-name: ** an n-formyl-l-methionylaminoacyl-trna == Reaction(s) known to consume the compound == * 3.5.1.2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DGDP ==
+
== Metabolite Charged-fMET-tRNAs ==
 
* common-name:
 
* common-name:
** dgdp
+
** an n-formyl-l-methionylaminoacyl-trna
* smiles:
 
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
** cikgwctvfsrmju-kvqbguixsa-k
 
* molecular-weight:
 
** 424.18
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDGD]]
+
* [[3.5.1.27-RXN]]
* [[DGDPKIN-RXN]]
 
* [[DGTPtm]]
 
* [[RXN-14207]]
 
* [[RXN-14218]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATDGM]]
 
* [[DGOTO]]
 
* [[DGTCY]]
 
* [[DGTPtm]]
 
* [[DGTUP]]
 
* [[GDPREDUCT-RXN]]
 
* [[RXN-14217]]
 
* [[RXN0-748]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dgdp}}
+
{{#set: common-name=an n-formyl-l-methionylaminoacyl-trna}}
{{#set: inchi-key=inchikey=cikgwctvfsrmju-kvqbguixsa-k}}
 
{{#set: molecular-weight=424.18}}
 

Revision as of 15:00, 5 January 2021

Metabolite Charged-fMET-tRNAs

  • common-name:
    • an n-formyl-l-methionylaminoacyl-trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality