Difference between revisions of "CPD-9903"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17127 RXN-17127] == * direction: ** left-to-right * common-name: ** lipoate-protein ligase * ec...")
(Created page with "Category:metabolite == Metabolite CPD-9903 == * common-name: ** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17127 RXN-17127] ==
+
== Metabolite CPD-9903 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** lipoate-protein ligase
+
** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.3.1.20 ec-6.3.1.20]
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[LIPOIC-ACID]][c] '''+''' 1 [[Lipoyl-Protein-L-Lysine]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Lipoyl-Protein-N6-lipoyllysine]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c]
+
** lieylsgxgoxytd-ctbyciiysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06657]]
+
** 629.941
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-9287]]
−
* Gene: [[SJ03663]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=3,4-dihydroxy-5-all-trans-heptaprenylbenzoate}}
−
* Gene: [[SJ04393]]
+
{{#set: inchi-key=inchikey=lieylsgxgoxytd-ctbyciiysa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=629.941}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ11692]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=49289 49289]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=lipoate-protein ligase}}
 
−
{{#set: ec-number=ec-6.3.1.20}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-9903

  • common-name:
    • 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
  • inchi-key:
    • lieylsgxgoxytd-ctbyciiysa-m
  • molecular-weight:
    • 629.941

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9903&oldid=138673"