Difference between revisions of "CPD-9903"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-745 RXN0-745] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....") |
(Created page with "Category:metabolite == Metabolite CPD-7139 == * common-name: ** delphinidin 3,5-di-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(c...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7139 == |
| − | * | + | * common-name: |
| − | ** | + | ** delphinidin 3,5-di-o-β-d-glucoside |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5))) |
| − | == | + | * inchi-key: |
| − | + | ** xctgxgvgjyacei-lcenjuansa-n | |
| − | = | + | * molecular-weight: |
| − | * | + | ** 626.524 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[RXN-8228]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=delphinidin 3,5-di-o-β-d-glucoside}} | |
| − | + | {{#set: inchi-key=inchikey=xctgxgvgjyacei-lcenjuansa-n}} | |
| − | * | + | {{#set: molecular-weight=626.524}} |
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPD-7139
- common-name:
- delphinidin 3,5-di-o-β-d-glucoside
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
- inchi-key:
- xctgxgvgjyacei-lcenjuansa-n
- molecular-weight:
- 626.524
