|
|
| (8 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOKINASE-RXN FRUCTOKINASE-RXN] == | + | == Metabolite CPD-9904 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** manno(fructo)kinase | + | ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate |
| − | * ec-number:
| + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.1.4 ec-2.7.1.4]
| + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[BETA-D-FRUCTOSE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[FRUCTOSE-6P]][c] '''+''' 1 [[PROTON]][c]
| + | ** kybjqeicwvewil-tuumqracsa-m |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ12224]]
| + | ** 643.968 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ04919]] | + | * [[RXN-9287]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}} |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=kybjqeicwvewil-tuumqracsa-m}} |
| − | == Pathway(s) == | + | {{#set: molecular-weight=643.968}} |
| − | * [[PWY-3801]], sucrose degradation II (sucrose synthase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3801 PWY-3801]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-621]], sucrose degradation III (sucrose invertase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-621 PWY-621]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
| |
| − | ** '''16''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY-4101]], D-sorbitol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-5384]], sucrose degradation IV (sucrose phosphorylase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5384 PWY-5384]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[SUCROSEUTIL2-PWY]], sucrose degradation VII (sucrose 3-dehydrogenase): [http://metacyc.org/META/NEW-IMAGE?object=SUCROSEUTIL2-PWY SUCROSEUTIL2-PWY]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[PWY-6531]], mannitol cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[SUCUTIL-PWY]], sucrose degradation I (sucrose phosphotransferase): [http://metacyc.org/META/NEW-IMAGE?object=SUCUTIL-PWY SUCUTIL-PWY] | |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA: | |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16126 16126]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00760 R00760]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q09124 Q09124]
| |
| − | ** [http://www.uniprot.org/uniprot/P24261 P24261]
| |
| − | ** [http://www.uniprot.org/uniprot/Q03417 Q03417]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9V0T7 Q9V0T7]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CFI9 Q9CFI9]
| |
| − | ** [http://www.uniprot.org/uniprot/P22824 P22824]
| |
| − | ** [http://www.uniprot.org/uniprot/P26420 P26420]
| |
| − | ** [http://www.uniprot.org/uniprot/P26984 P26984]
| |
| − | ** [http://www.uniprot.org/uniprot/P37829 P37829]
| |
| − | ** [http://www.uniprot.org/uniprot/P43468 P43468]
| |
| − | ** [http://www.uniprot.org/uniprot/P73521 P73521]
| |
| − | ** [http://www.uniprot.org/uniprot/O82616 O82616]
| |
| − | ** [http://www.uniprot.org/uniprot/O04897 O04897]
| |
| − | ** [http://www.uniprot.org/uniprot/Q42645 Q42645]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=manno(fructo)kinase}} | |
| − | {{#set: ec-number=ec-2.7.1.4}}
| |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=8}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
| |
