Difference between revisions of "CPD-9904"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13793 == * common-name: ** 3-oxo-24-ethyl-cholest-5-ene * smiles: ** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(...") |
(Created page with "Category:metabolite == Metabolite CPD-9904 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-9904 == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kybjqeicwvewil-tuumqracsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 643.968 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9287]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kybjqeicwvewil-tuumqracsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=643.968}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-9904
- common-name:
- 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
- inchi-key:
- kybjqeicwvewil-tuumqracsa-m
- molecular-weight:
- 643.968
