Difference between revisions of "CPD-9904"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-578 RXN66-578] == * direction: ** left-to-right * common-name: ** diacylglycerol cholinephosp...")
 
(Created page with "Category:metabolite == Metabolite CPD-9904 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-578 RXN66-578] ==
+
== Metabolite CPD-9904 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** diacylglycerol cholinephosphotransferase
+
** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.8.2 ec-2.7.8.2]
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CDP-CHOLINE]][c] '''+''' 1 [[CPD66-34]][c] '''=>''' 1 [[1-2-DIPALMITOYLPHOSPHATIDYLCHOLINE]][c] '''+''' 1 [[CMP]][c] '''+''' 1 [[PROTON]][c]
+
** kybjqeicwvewil-tuumqracsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06171]]
+
** 643.968
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ19317]]
+
* [[RXN-9287]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=kybjqeicwvewil-tuumqracsa-m}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=643.968}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=diacylglycerol cholinephosphotransferase}}
 
−
{{#set: ec-number=ec-2.7.8.2}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-9904

  • common-name:
    • 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
  • inchi-key:
    • kybjqeicwvewil-tuumqracsa-m
  • molecular-weight:
    • 643.968

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9904&oldid=139280"