Difference between revisions of "CPD-9924"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13852 == * common-name: ** 2-hydroxy-damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc(=o)n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-17640 == * common-name: ** 18-hydroxystearate * smiles: ** c(o)ccccccccccccccccc([o-])=o * inchi-key: ** vlhzuyuoegbbjb-uhfffaoysa-m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-17640 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 18-hydroxystearate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)ccccccccccccccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vlhzuyuoegbbjb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 299.473 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16401]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=18-hydroxystearate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vlhzuyuoegbbjb-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=299.473}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-17640
- common-name:
- 18-hydroxystearate
- smiles:
- c(o)ccccccccccccccccc([o-])=o
- inchi-key:
- vlhzuyuoegbbjb-uhfffaoysa-m
- molecular-weight:
- 299.473
