Difference between revisions of "CPD-9924"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13852 == * common-name: ** 2-hydroxy-damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc(=o)n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-9924 == * common-name: ** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate * smiles: ** c=c(c(=o)[o-])oc1(cc=c(c(=o)cc...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-9924 == |
* common-name: | * common-name: | ||
| − | ** 2-hydroxy- | + | ** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c=c(c(=o)[o-])oc1(cc=c(c(=o)ccc(=o)[o-])c(c(o)1)c(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jkjglrglomrxfn-mvwjerbfsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 325.251 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.5.1.64-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2-hydroxy- | + | {{#set: common-name=2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jkjglrglomrxfn-mvwjerbfsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=325.251}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-9924
- common-name:
- 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate
- smiles:
- c=c(c(=o)[o-])oc1(cc=c(c(=o)ccc(=o)[o-])c(c(o)1)c(=o)[o-])
- inchi-key:
- jkjglrglomrxfn-mvwjerbfsa-k
- molecular-weight:
- 325.251
