Difference between revisions of "CPD-9924"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PNKIN-RXN PNKIN-RXN] == * direction: ** left-to-right * common-name: ** pyridoxine kinase * ec-numb...")
(Created page with "Category:metabolite == Metabolite CPD-9924 == * common-name: ** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate * smiles: ** c=c(c(=o)[o-])oc1(cc=c(c(=o)cc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PNKIN-RXN PNKIN-RXN] ==
+
== Metabolite CPD-9924 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** pyridoxine kinase
+
** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.7.1.35 ec-2.7.1.35]
+
** c=c(c(=o)[o-])oc1(cc=c(c(=o)ccc(=o)[o-])c(c(o)1)c(=o)[o-])
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 1 [[PYRIDOXINE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PYRIDOXINE-5P]][c]
+
** jkjglrglomrxfn-mvwjerbfsa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ08289]]
+
** 325.251
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ14436]]
+
* [[2.5.1.64-RXN]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=jkjglrglomrxfn-mvwjerbfsa-k}}
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=325.251}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
== Pathway(s) ==
 
* [[PLPSAL-PWY]], pyridoxal 5'-phosphate salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PLPSAL-PWY PLPSAL-PWY]
 
** '''5''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-7282]], 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282]
 
** '''6''' reactions found over '''9''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25109 25109]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01909 R01909]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=pyridoxine kinase}}
 
{{#set: ec-number=ec-2.7.1.35}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=3}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9924

  • common-name:
    • 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate
  • smiles:
    • c=c(c(=o)[o-])oc1(cc=c(c(=o)ccc(=o)[o-])c(c(o)1)c(=o)[o-])
  • inchi-key:
    • jkjglrglomrxfn-mvwjerbfsa-k
  • molecular-weight:
    • 325.251

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality