Difference between revisions of "CPD-9925"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Long-linear-glucans == * common-name: ** a long-linear α-d-glucan == Reaction(s) known to consume the compound == * RXN-1825 *...")
(Created page with "Category:metabolite == Metabolite CPD-13227 == * common-name: ** n,n',n''-triacetylchitotriose * smiles: ** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Long-linear-glucans ==
+
== Metabolite CPD-13227 ==
 
* common-name:
 
* common-name:
** a long-linear α-d-glucan
+
** n,n',n''-triacetylchitotriose
 +
* smiles:
 +
** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(c(o)c(o)c(nc(c)=o)3)co)))
 +
* inchi-key:
 +
** wzzvuhwlnmnwlw-mewklcdlsa-n
 +
* molecular-weight:
 +
** 627.598
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1825]]
 
* [[RXN-1826]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1826]]
+
* [[RXN-12623]]
 +
* [[RXN-12624]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a long-linear α-d-glucan}}
+
{{#set: common-name=n,n',n''-triacetylchitotriose}}
 +
{{#set: inchi-key=inchikey=wzzvuhwlnmnwlw-mewklcdlsa-n}}
 +
{{#set: molecular-weight=627.598}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-13227

  • common-name:
    • n,n',n-triacetylchitotriose
  • smiles:
    • cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(c(o)c(o)c(nc(c)=o)3)co)))
  • inchi-key:
    • wzzvuhwlnmnwlw-mewklcdlsa-n
  • molecular-weight:
    • 627.598

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality