Difference between revisions of "CPD-9955"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOBUTYRATE == * common-name: ** 3-hydroxy-isobutanoate == Reaction(s) known to consume the compound == == Reaction(s) known to...")
(Created page with "Category:metabolite == Metabolite CPD-511 == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co * inchi-key: ** znxzgrmvnnhpca-vifpvbqesa-n * molecu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-ISOBUTYRATE ==
+
== Metabolite CPD-511 ==
 
* common-name:
 
* common-name:
** 3-hydroxy-isobutanoate
+
** pantetheine
 +
* smiles:
 +
** cc(c(o)c(=o)nccc(nccs)=o)(c)co
 +
* inchi-key:
 +
** znxzgrmvnnhpca-vifpvbqesa-n
 +
* molecular-weight:
 +
** 278.366
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PANTETHEINE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13721]]
+
* [[PANTETHEINE-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxy-isobutanoate}}
+
{{#set: common-name=pantetheine}}
 +
{{#set: inchi-key=inchikey=znxzgrmvnnhpca-vifpvbqesa-n}}
 +
{{#set: molecular-weight=278.366}}

Revision as of 13:09, 14 January 2021

Metabolite CPD-511

  • common-name:
    • pantetheine
  • smiles:
    • cc(c(o)c(=o)nccc(nccs)=o)(c)co
  • inchi-key:
    • znxzgrmvnnhpca-vifpvbqesa-n
  • molecular-weight:
    • 278.366

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality