Difference between revisions of "CPD-9955"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-511 == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co * inchi-key: ** znxzgrmvnnhpca-vifpvbqesa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite CPD-2752 == * common-name: ** trans-3-hydroxycotinine-glucuronide * smiles: ** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-2752 == |
* common-name: | * common-name: | ||
| − | ** | + | ** trans-3-hydroxycotinine-glucuronide |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=cn=cc=c3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** walnnkzughysct-mbwyjtgfsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 367.335 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-162]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=trans-3-hydroxycotinine-glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=walnnkzughysct-mbwyjtgfsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=367.335}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-2752
- common-name:
- trans-3-hydroxycotinine-glucuronide
- smiles:
- c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=cn=cc=c3))
- inchi-key:
- walnnkzughysct-mbwyjtgfsa-m
- molecular-weight:
- 367.335
